C10H13ClN2O2S — CID 88772913
O-(1-hydroxy-2-methylpropan-2-yl) N-(5-chloro-2-pyridinyl)carbamothioate (PubChem CID 88772913) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is O-(1-hydroxy-2-methylpropan-2-yl) N-(5-chloro-2-pyridinyl)carbamothioate.
| Compound Name | O-(1-hydroxy-2-methylpropan-2-yl) N-(5-chloro-2-pyridinyl)carbamothioate |
|---|---|
| PubChem CID | 88772913 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | O-(1-hydroxy-2-methylpropan-2-yl) N-(5-chloro-2-pyridinyl)carbamothioate |
| SMILES | CC(C)(CO)OC(=S)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H13ClN2O2S/c1-10(2,6-14)15-9(16)13-8-4-3-7(11)5-12-8/h3-5,14H,6H2,1-2H3,(H,12,13,16) |
| InChIKey | NWZOJTDAGCDOKU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|