C15H14ClN3O3S2 — CID 88771809
carbamothioic S-acid;O-phenacyl N-(5-chloro-2-pyridinyl)carbamothioate (PubChem CID 88771809) has the molecular formula C15H14ClN3O3S2 and a molecular weight of 383.88 g/mol. Its IUPAC name is carbamothioic S-acid;O-phenacyl N-(5-chloro-2-pyridinyl)carbamothioate.
| Compound Name | carbamothioic S-acid;O-phenacyl N-(5-chloro-2-pyridinyl)carbamothioate |
|---|---|
| PubChem CID | 88771809 |
| Molecular Formula | C15H14ClN3O3S2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | carbamothioic S-acid;O-phenacyl N-(5-chloro-2-pyridinyl)carbamothioate |
| SMILES | NC(=O)S.O=C(COC(=S)Nc1ccc(Cl)cn1)c1ccccc1 |
| InChI | InChI=1S/C14H11ClN2O2S.CH3NOS/c15-11-6-7-13(16-8-11)17-14(20)19-9-12(18)10-4-2-1-3-5-10;2-1(3)4/h1-8H,9H2,(H,16,17,20);(H3,2,3,4) |
| InChIKey | UCAYBFMMWGWPPF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|