C15H12ClFN2O3S — CID 7355006
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7355006) has the molecular formula C15H12ClFN2O3S and a molecular weight of 354.79 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7355006 |
| Molecular Formula | C15H12ClFN2O3S |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccccc1F)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H12ClFN2O3S/c16-10-5-6-13(18-7-10)19-14(20)8-22-15(21)9-23-12-4-2-1-3-11(12)17/h1-7H,8-9H2,(H,18,19,20) |
| InChIKey | WGAYHPHGNJSUCO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |