C15H14ClN3O5S — CID 3532838
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(benzenesulfonamido)acetate (PubChem CID 3532838) has the molecular formula C15H14ClN3O5S and a molecular weight of 383.81 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(benzenesulfonamido)acetate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 3532838 |
| Molecular Formula | C15H14ClN3O5S |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H14ClN3O5S/c16-11-6-7-13(17-8-11)19-14(20)10-24-15(21)9-18-25(22,23)12-4-2-1-3-5-12/h1-8,18H,9-10H2,(H,17,19,20) |
| InChIKey | RKKGWKZXEZNDFI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |