C13H13N3O6S — CID 16599847
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-(benzenesulfonamido)acetate (PubChem CID 16599847) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-(benzenesulfonamido)acetate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 16599847 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-(benzenesulfonamido)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1ccccc1)Nc1ccon1 |
| InChI | InChI=1S/C13H13N3O6S/c17-12(15-11-6-7-22-16-11)9-21-13(18)8-14-23(19,20)10-4-2-1-3-5-10/h1-7,14H,8-9H2,(H,15,16,17) |
| InChIKey | TVWPLAYHCYGWRC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |