C15H21N3O6S — CID 8523115
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate (PubChem CID 8523115) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 8523115 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-(benzenesulfonamido)acetate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O6S/c1-3-11(2)17-15(21)18-13(19)10-24-14(20)9-16-25(22,23)12-7-5-4-6-8-12/h4-8,11,16H,3,9-10H2,1-2H3,(H2,17,18,19,21)/t11-/m0/s1 |
| InChIKey | SEUUVZISKYSAGT-NSHDSACASA-N |
| XLogP | 0.13 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |