C18H20N2O7S — CID 8664557
(2-anilino-2-oxoethyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate (PubChem CID 8664557) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 8664557 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)OCC(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H20N2O7S/c1-25-15-9-8-14(10-16(15)26-2)28(23,24)19-11-18(22)27-12-17(21)20-13-6-4-3-5-7-13/h3-10,19H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | XDDDDGFZNDHFLU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |