C13H11ClN2O3S — CID 2985129
2-(benzenesulfonyl)-N-(5-chloro-2-pyridinyl)acetamide (PubChem CID 2985129) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(5-chloro-2-pyridinyl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(5-chloro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 2985129 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(5-chloro-2-pyridinyl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11ClN2O3S/c14-10-6-7-12(15-8-10)16-13(17)9-20(18,19)11-4-2-1-3-5-11/h1-8H,9H2,(H,15,16,17) |
| InChIKey | JKNDGNRPGLDMAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |