C15H13ClN2O4S — CID 51193950
N'-[2-(4-chlorophenyl)sulfonylacetyl]benzohydrazide (PubChem CID 51193950) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfonylacetyl]benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfonylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 51193950 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfonylacetyl]benzohydrazide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O4S/c16-12-6-8-13(9-7-12)23(21,22)10-14(19)17-18-15(20)11-4-2-1-3-5-11/h1-9H,10H2,(H,17,19)(H,18,20) |
| InChIKey | JXLZMQNXHKIUDI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|