C15H13ClFNO3S — CID 34381808
2-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 34381808) has the molecular formula C15H13ClFNO3S and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 34381808 |
| Molecular Formula | C15H13ClFNO3S |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)NCc1ccccc1F |
| InChI | InChI=1S/C15H13ClFNO3S/c16-12-5-7-13(8-6-12)22(20,21)10-15(19)18-9-11-3-1-2-4-14(11)17/h1-8H,9-10H2,(H,18,19) |
| InChIKey | CZINCZDLKDOOBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |