C16H15ClFNO3S — CID 34450269
2-(4-chlorophenyl)sulfonyl-N-[2-(3-fluorophenyl)ethyl]acetamide (PubChem CID 34450269) has the molecular formula C16H15ClFNO3S and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[2-(3-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(3-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 34450269 |
| Molecular Formula | C16H15ClFNO3S |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[2-(3-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C16H15ClFNO3S/c17-13-4-6-15(7-5-13)23(21,22)11-16(20)19-9-8-12-2-1-3-14(18)10-12/h1-7,10H,8-9,11H2,(H,19,20) |
| InChIKey | NSKJIBSWOJAEQS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |