C18H19ClFNOS — CID 3512806
N-[2-(4-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methylsulfanyl]propanamide (PubChem CID 3512806) has the molecular formula C18H19ClFNOS and a molecular weight of 351.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methylsulfanyl]propanamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 3512806 |
| Molecular Formula | C18H19ClFNOS |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-3-[(3-fluorophenyl)methylsulfanyl]propanamide |
| SMILES | O=C(CCSCc1cccc(F)c1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClFNOS/c19-16-6-4-14(5-7-16)8-10-21-18(22)9-11-23-13-15-2-1-3-17(20)12-15/h1-7,12H,8-11,13H2,(H,21,22) |
| InChIKey | BUUBNPAFGRIIIE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|