C17H19FN2O3S — CID 18118763
3-(benzenesulfonamido)-N-[2-(3-fluorophenyl)ethyl]propanamide (PubChem CID 18118763) has the molecular formula C17H19FN2O3S and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-(3-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-(3-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 18118763 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-(3-fluorophenyl)ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN2O3S/c18-15-6-4-5-14(13-15)9-11-19-17(21)10-12-20-24(22,23)16-7-2-1-3-8-16/h1-8,13,20H,9-12H2,(H,19,21) |
| InChIKey | IKUBMFRMHBRYHQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |