C17H18BrFN2O3S — CID 52703842
3-(benzenesulfonamido)-N-[2-(3-bromo-4-fluorophenyl)ethyl]propanamide (PubChem CID 52703842) has the molecular formula C17H18BrFN2O3S and a molecular weight of 429.31 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-(3-bromo-4-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-(3-bromo-4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 52703842 |
| Molecular Formula | C17H18BrFN2O3S |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-(3-bromo-4-fluorophenyl)ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)NCCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H18BrFN2O3S/c18-15-12-13(6-7-16(15)19)8-10-20-17(22)9-11-21-25(23,24)14-4-2-1-3-5-14/h1-7,12,21H,8-11H2,(H,20,22) |
| InChIKey | AFFVARLEHIFXPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |