C15H15BrF2NO5PS — CID 11677150
[[4-[2-(benzenesulfonamido)ethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (PubChem CID 11677150) has the molecular formula C15H15BrF2NO5PS and a molecular weight of 470.23 g/mol. Its IUPAC name is [[4-[2-(benzenesulfonamido)ethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-(benzenesulfonamido)ethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11677150 |
| Molecular Formula | C15H15BrF2NO5PS |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | [[4-[2-(benzenesulfonamido)ethyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CCNS(=O)(=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C15H15BrF2NO5PS/c16-14-10-11(6-7-13(14)15(17,18)25(20,21)22)8-9-19-26(23,24)12-4-2-1-3-5-12/h1-7,10,19H,8-9H2,(H2,20,21,22) |
| InChIKey | WBVSNDWAWDBMFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|