C16H18N2O3S — CID 54332606
2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetamide (PubChem CID 54332606) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetamide.
| Compound Name | 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54332606 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[4-[2-(benzenesulfonamido)ethyl]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(CCNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O3S/c17-16(19)12-14-8-6-13(7-9-14)10-11-18-22(20,21)15-4-2-1-3-5-15/h1-9,18H,10-12H2,(H2,17,19) |
| InChIKey | SZJZIMSQKBQKKW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |