C14H15NO4S — CID 90129375
N-[2-(3,4-dihydroxyphenyl)ethyl]benzenesulfonamide (PubChem CID 90129375) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90129375 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C14H15NO4S/c16-13-7-6-11(10-14(13)17)8-9-15-20(18,19)12-4-2-1-3-5-12/h1-7,10,15-17H,8-9H2 |
| InChIKey | ZFVOWCPQRJQSKX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|