C19H23NO4S — CID 57249051
ethyl 3-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoate (PubChem CID 57249051) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl 3-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 57249051 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | ethyl 3-[4-[2-(benzenesulfonamido)ethyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(CCNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-2-24-19(21)13-12-16-8-10-17(11-9-16)14-15-20-25(22,23)18-6-4-3-5-7-18/h3-11,20H,2,12-15H2,1H3 |
| InChIKey | ARKABHHJZZHGHH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |