C10H13BrF2NO3P — CID 11681703
[[2-bromo-4-(ethylaminomethyl)phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11681703) has the molecular formula C10H13BrF2NO3P and a molecular weight of 344.09 g/mol. Its IUPAC name is [[2-bromo-4-(ethylaminomethyl)phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-(ethylaminomethyl)phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11681703 |
| Molecular Formula | C10H13BrF2NO3P |
| Molecular Weight | 344.09 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | [[2-bromo-4-(ethylaminomethyl)phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CCNCc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C10H13BrF2NO3P/c1-2-14-6-7-3-4-8(9(11)5-7)10(12,13)18(15,16)17/h3-5,14H,2,6H2,1H3,(H2,15,16,17) |
| InChIKey | XEADISZTTGRUHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.09 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|