C23H23BrF3NO6P2 — CID 143170583
[1-[4-[[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]anilino]methyl]phenyl]-1-fluoroethyl]phosphonic acid (PubChem CID 143170583) has the molecular formula C23H23BrF3NO6P2 and a molecular weight of 608.28 g/mol. Its IUPAC name is [1-[4-[[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]anilino]methyl]phenyl]-1-fluoroethyl]phosphonic acid.
| Compound Name | [1-[4-[[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]anilino]methyl]phenyl]-1-fluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 143170583 |
| Molecular Formula | C23H23BrF3NO6P2 |
| Molecular Weight | 608.28 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | [1-[4-[[N-[[3-bromo-4-[difluoro(phosphono)methyl]phenyl]methyl]anilino]methyl]phenyl]-1-fluoroethyl]phosphonic acid |
| SMILES | CC(F)(c1ccc(CN(Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)c2ccccc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C23H23BrF3NO6P2/c1-22(25,35(29,30)31)18-10-7-16(8-11-18)14-28(19-5-3-2-4-6-19)15-17-9-12-20(21(24)13-17)23(26,27)36(32,33)34/h2-13H,14-15H2,1H3,(H2,29,30,31)(H2,32,33,34) |
| InChIKey | XJBGGNWAHWQVTI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|