C23H20BrF2N2O6PS — CID 11606837
[[2-bromo-4-[[(4-cyanophenyl)methyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11606837) has the molecular formula C23H20BrF2N2O6PS and a molecular weight of 601.36 g/mol. Its IUPAC name is [[2-bromo-4-[[(4-cyanophenyl)methyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[[(4-cyanophenyl)methyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11606837 |
| Molecular Formula | C23H20BrF2N2O6PS |
| Molecular Weight | 601.36 g/mol |
| Exact Mass | 599.99 |
| IUPAC Name | [[2-bromo-4-[[(4-cyanophenyl)methyl-(2-methoxyphenyl)sulfonylamino]methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | COc1ccccc1S(=O)(=O)N(Cc1ccc(C#N)cc1)Cc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C23H20BrF2N2O6PS/c1-34-21-4-2-3-5-22(21)36(32,33)28(14-17-8-6-16(13-27)7-9-17)15-18-10-11-19(20(24)12-18)23(25,26)35(29,30)31/h2-12H,14-15H2,1H3,(H2,29,30,31) |
| InChIKey | PXGWGJFBPNVTOW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|