C28H31BrF2NO10PS2 — CID 58663197
[[2-bromo-4-[(N-(2-methoxyphenyl)sulfonyl-4-methylsulfonylanilino)methyl]phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 58663197) has the molecular formula C28H31BrF2NO10PS2 and a molecular weight of 754.56 g/mol. Its IUPAC name is [[2-bromo-4-[(N-(2-methoxyphenyl)sulfonyl-4-methylsulfonylanilino)methyl]phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [[2-bromo-4-[(N-(2-methoxyphenyl)sulfonyl-4-methylsulfonylanilino)methyl]phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 58663197 |
| Molecular Formula | C28H31BrF2NO10PS2 |
| Molecular Weight | 754.56 g/mol |
| Exact Mass | 753.03 |
| IUPAC Name | [[2-bromo-4-[(N-(2-methoxyphenyl)sulfonyl-4-methylsulfonylanilino)methyl]phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | COc1ccccc1S(=O)(=O)N(Cc1ccc(C(F)(F)P(=O)(O)OCOC(=O)C(C)(C)C)c(Br)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H31BrF2NO10PS2/c1-27(2,3)26(33)41-18-42-43(34,35)28(30,31)22-15-10-19(16-23(22)29)17-32(20-11-13-21(14-12-20)44(5,36)37)45(38,39)25-9-7-6-8-24(25)40-4/h6-16H,17-18H2,1-5H3,(H,34,35) |
| InChIKey | ATVUPEXWOBOMFZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|