C28H28BrF2O6P — CID 59893427
[[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 59893427) has the molecular formula C28H28BrF2O6P and a molecular weight of 609.40 g/mol. Its IUPAC name is [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 59893427 |
| Molecular Formula | C28H28BrF2O6P |
| Molecular Weight | 609.40 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(F)(F)c1ccc(CC(C(=O)c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C28H28BrF2O6P/c1-27(2,3)26(33)36-18-37-38(34,35)28(30,31)23-15-14-19(17-24(23)29)16-22(20-10-6-4-7-11-20)25(32)21-12-8-5-9-13-21/h4-15,17,22H,16,18H2,1-3H3,(H,34,35) |
| InChIKey | WZUYIOULITZANF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.40 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|