C27H26BrF2O7P — CID 59893432
[[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 59893432) has the molecular formula C27H26BrF2O7P and a molecular weight of 611.37 g/mol. Its IUPAC name is [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 59893432 |
| Molecular Formula | C27H26BrF2O7P |
| Molecular Weight | 611.37 g/mol |
| Exact Mass | 610.06 |
| IUPAC Name | [[2-bromo-4-(3-oxo-2,3-diphenylpropyl)phenyl]-difluoromethyl]-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)C(F)(F)c1ccc(CC(C(=O)c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C27H26BrF2O7P/c1-18(2)37-26(32)35-17-36-38(33,34)27(29,30)23-14-13-19(16-24(23)28)15-22(20-9-5-3-6-10-20)25(31)21-11-7-4-8-12-21/h3-14,16,18,22H,15,17H2,1-2H3,(H,33,34) |
| InChIKey | NWVRQVLQUGEWCT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.37 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|