C15H22BrF2N2O4P — CID 58918852
(2S)-2-amino-3-[3-bromo-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-N-methylpropanamide (PubChem CID 58918852) has the molecular formula C15H22BrF2N2O4P and a molecular weight of 443.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-bromo-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-N-methylpropanamide.
| Compound Name | (2S)-2-amino-3-[3-bromo-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 58918852 |
| Molecular Formula | C15H22BrF2N2O4P |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (2S)-2-amino-3-[3-bromo-4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-N-methylpropanamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(C[C@H](N)C(=O)NC)cc1Br |
| InChI | InChI=1S/C15H22BrF2N2O4P/c1-4-23-25(22,24-5-2)15(17,18)11-7-6-10(8-12(11)16)9-13(19)14(21)20-3/h6-8,13H,4-5,9,19H2,1-3H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | OZPXGJOIPWIAGV-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|