C17H26F2NO4P — CID 58918877
(2S)-3-[4-[diethoxyphosphoryl(difluoro)methyl]-3-methylphenyl]-N,2-dimethylpropanamide (PubChem CID 58918877) has the molecular formula C17H26F2NO4P and a molecular weight of 377.37 g/mol. Its IUPAC name is (2S)-3-[4-[diethoxyphosphoryl(difluoro)methyl]-3-methylphenyl]-N,2-dimethylpropanamide.
| Compound Name | (2S)-3-[4-[diethoxyphosphoryl(difluoro)methyl]-3-methylphenyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58918877 |
| Molecular Formula | C17H26F2NO4P |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-3-[4-[diethoxyphosphoryl(difluoro)methyl]-3-methylphenyl]-N,2-dimethylpropanamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(C[C@H](C)C(=O)NC)cc1C |
| InChI | InChI=1S/C17H26F2NO4P/c1-6-23-25(22,24-7-2)17(18,19)15-9-8-14(10-12(15)3)11-13(4)16(21)20-5/h8-10,13H,6-7,11H2,1-5H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | UXFAHRPHTSONAL-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|