C13H13F6NO — CID 123596150
3-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide (PubChem CID 123596150) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123596150 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO/c1-7(11(21)20-2)3-8-4-9(12(14,15)16)6-10(5-8)13(17,18)19/h4-7H,3H2,1-2H3,(H,20,21) |
| InChIKey | YVCVPANREWETOD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |