C16H21F3N2O — CID 119386828
2-methyl-N-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 119386828) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-methyl-N-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-methyl-N-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 119386828 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-methyl-N-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C16H21F3N2O/c1-11(15(22)21-14-5-7-20-8-6-14)9-12-3-2-4-13(10-12)16(17,18)19/h2-4,10-11,14,20H,5-9H2,1H3,(H,21,22) |
| InChIKey | OCKMGITUSSTROY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |