C12H14F3NO3S — CID 94087753
(2S)-N-methyl-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]propanamide (PubChem CID 94087753) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is (2S)-N-methyl-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]propanamide.
| Compound Name | (2S)-N-methyl-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 94087753 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2S)-N-methyl-2-[[3-(trifluoromethyl)phenyl]methylsulfonyl]propanamide |
| SMILES | CNC(=O)[C@H](C)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-8(11(17)16-2)20(18,19)7-9-4-3-5-10(6-9)12(13,14)15/h3-6,8H,7H2,1-2H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | XLAOFQSYIXYKMD-QMMMGPOBSA-N |
| XLogP | 1.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |