C10H9F3N2O2S — CID 15616017
N-(cyanomethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 15616017) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.26 g/mol. Its IUPAC name is N-(cyanomethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(cyanomethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 15616017 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | N-(cyanomethyl)-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | N#CCNS(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O2S/c11-10(12,13)9-3-1-2-8(6-9)7-18(16,17)15-5-4-14/h1-3,6,15H,5,7H2 |
| InChIKey | OFHGHOZFJGDMGH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|