C15H21F3N2O2S — CID 120719963
N-[(4-methylpiperidin-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 120719963) has the molecular formula C15H21F3N2O2S and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[(4-methylpiperidin-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[(4-methylpiperidin-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 120719963 |
| Molecular Formula | C15H21F3N2O2S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[(4-methylpiperidin-4-yl)methyl]-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CC1(CNS(=O)(=O)Cc2cccc(C(F)(F)F)c2)CCNCC1 |
| InChI | InChI=1S/C15H21F3N2O2S/c1-14(5-7-19-8-6-14)11-20-23(21,22)10-12-3-2-4-13(9-12)15(16,17)18/h2-4,9,19-20H,5-8,10-11H2,1H3 |
| InChIKey | ZMHFDISSYCGGHY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |