C14H18F4N2O2S — CID 120720257
4-fluoro-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 120720257) has the molecular formula C14H18F4N2O2S and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-fluoro-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120720257 |
| Molecular Formula | C14H18F4N2O2S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-fluoro-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2ccc(F)cc2C(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C14H18F4N2O2S/c1-13(4-6-19-7-5-13)9-20-23(21,22)12-3-2-10(15)8-11(12)14(16,17)18/h2-3,8,19-20H,4-7,9H2,1H3 |
| InChIKey | DLZNKGMPVDWCNG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |