C14H19ClF3N3O4S — CID 120720476
N-[(4-methylpiperidin-4-yl)methyl]-4-nitro-2-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 120720476) has the molecular formula C14H19ClF3N3O4S and a molecular weight of 417.84 g/mol. Its IUPAC name is N-[(4-methylpiperidin-4-yl)methyl]-4-nitro-2-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[(4-methylpiperidin-4-yl)methyl]-4-nitro-2-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120720476 |
| Molecular Formula | C14H19ClF3N3O4S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-[(4-methylpiperidin-4-yl)methyl]-4-nitro-2-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CC1(CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2C(F)(F)F)CCNCC1.Cl |
| InChI | InChI=1S/C14H18F3N3O4S.ClH/c1-13(4-6-18-7-5-13)9-19-25(23,24)12-3-2-10(20(21)22)8-11(12)14(15,16)17;/h2-3,8,18-19H,4-7,9H2,1H3;1H |
| InChIKey | GLNKBYKZUVIELH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|