C12H14F3N3O4S — CID 119969918
2-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 119969918) has the molecular formula C12H14F3N3O4S and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 2-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 119969918 |
| Molecular Formula | C12H14F3N3O4S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-methyl-1-[4-nitro-2-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | CC1CNCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O4S/c1-8-7-16-4-5-17(8)23(21,22)11-3-2-9(18(19)20)6-10(11)12(13,14)15/h2-3,6,8,16H,4-5,7H2,1H3 |
| InChIKey | SKHWMWRPSFGWLD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|