C12H19Cl2N3O4S — CID 166174854
2-methyl-1-(2-methylsulfonyl-5-nitrophenyl)piperazine;dihydrochloride (PubChem CID 166174854) has the molecular formula C12H19Cl2N3O4S and a molecular weight of 372.27 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfonyl-5-nitrophenyl)piperazine;dihydrochloride.
| Compound Name | 2-methyl-1-(2-methylsulfonyl-5-nitrophenyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 166174854 |
| Molecular Formula | C12H19Cl2N3O4S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-methyl-1-(2-methylsulfonyl-5-nitrophenyl)piperazine;dihydrochloride |
| SMILES | CC1CNCCN1c1cc([N+](=O)[O-])ccc1S(C)(=O)=O.Cl.Cl |
| InChI | InChI=1S/C12H17N3O4S.2ClH/c1-9-8-13-5-6-14(9)11-7-10(15(16)17)3-4-12(11)20(2,18)19;;/h3-4,7,9,13H,5-6,8H2,1-2H3;2*1H |
| InChIKey | DBXIKCDHRKDKSG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|