C13H21Cl2N3O4S — CID 166174872
[1-(2-methylsulfonyl-5-nitrophenyl)piperidin-4-yl]methanamine;dihydrochloride (PubChem CID 166174872) has the molecular formula C13H21Cl2N3O4S and a molecular weight of 386.30 g/mol. Its IUPAC name is [1-(2-methylsulfonyl-5-nitrophenyl)piperidin-4-yl]methanamine;dihydrochloride.
| Compound Name | [1-(2-methylsulfonyl-5-nitrophenyl)piperidin-4-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 166174872 |
| Molecular Formula | C13H21Cl2N3O4S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [1-(2-methylsulfonyl-5-nitrophenyl)piperidin-4-yl]methanamine;dihydrochloride |
| SMILES | CS(=O)(=O)c1ccc([N+](=O)[O-])cc1N1CCC(CN)CC1.Cl.Cl |
| InChI | InChI=1S/C13H19N3O4S.2ClH/c1-21(19,20)13-3-2-11(16(17)18)8-12(13)15-6-4-10(9-14)5-7-15;;/h2-3,8,10H,4-7,9,14H2,1H3;2*1H |
| InChIKey | PMAKYHKPHBNOGX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|