C12H18ClN3O5S — CID 119969721
1-(4-methoxy-2-nitrophenyl)sulfonyl-2-methylpiperazine;hydrochloride (PubChem CID 119969721) has the molecular formula C12H18ClN3O5S and a molecular weight of 351.81 g/mol. Its IUPAC name is 1-(4-methoxy-2-nitrophenyl)sulfonyl-2-methylpiperazine;hydrochloride.
| Compound Name | 1-(4-methoxy-2-nitrophenyl)sulfonyl-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119969721 |
| Molecular Formula | C12H18ClN3O5S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-(4-methoxy-2-nitrophenyl)sulfonyl-2-methylpiperazine;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCNCC2C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C12H17N3O5S.ClH/c1-9-8-13-5-6-14(9)21(18,19)12-4-3-10(20-2)7-11(12)15(16)17;/h3-4,7,9,13H,5-6,8H2,1-2H3;1H |
| InChIKey | ILMRAXRIPLDMSY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|