C11H12F3N3O4S — CID 119967031
4-nitro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 119967031) has the molecular formula C11H12F3N3O4S and a molecular weight of 339.30 g/mol. Its IUPAC name is 4-nitro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-nitro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119967031 |
| Molecular Formula | C11H12F3N3O4S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-nitro-N-pyrrolidin-3-yl-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NC2CCNC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3N3O4S/c12-11(13,14)9-5-8(17(18)19)1-2-10(9)22(20,21)16-7-3-4-15-6-7/h1-2,5,7,15-16H,3-4,6H2 |
| InChIKey | KBYJYJJIVSSNDL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|