C10H11Cl2N3O4S — CID 104861916
2,4-dichloro-3-nitro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide (PubChem CID 104861916) has the molecular formula C10H11Cl2N3O4S and a molecular weight of 340.19 g/mol. Its IUPAC name is 2,4-dichloro-3-nitro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-nitro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 104861916 |
| Molecular Formula | C10H11Cl2N3O4S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 2,4-dichloro-3-nitro-N-[(3S)-pyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1c(Cl)ccc(S(=O)(=O)N[C@H]2CCNC2)c1Cl |
| InChI | InChI=1S/C10H11Cl2N3O4S/c11-7-1-2-8(9(12)10(7)15(16)17)20(18,19)14-6-3-4-13-5-6/h1-2,6,13-14H,3-5H2/t6-/m0/s1 |
| InChIKey | YGHAHQHSWKJQBJ-LURJTMIESA-N |
| XLogP | 1.54 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|