C9H12N4O4S — CID 71635717
5-nitro-N-pyrrolidin-3-ylpyridine-2-sulfonamide (PubChem CID 71635717) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-nitro-N-pyrrolidin-3-ylpyridine-2-sulfonamide.
| Compound Name | 5-nitro-N-pyrrolidin-3-ylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 71635717 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-nitro-N-pyrrolidin-3-ylpyridine-2-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NC2CCNC2)nc1 |
| InChI | InChI=1S/C9H12N4O4S/c14-13(15)8-1-2-9(11-6-8)18(16,17)12-7-3-4-10-5-7/h1-2,6-7,10,12H,3-5H2 |
| InChIKey | KRZFDGLIDPHKAJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|