C11H17ClN4O4S — CID 71635724
5-nitro-N-(piperidin-3-ylmethyl)pyridine-2-sulfonamide;hydrochloride (PubChem CID 71635724) has the molecular formula C11H17ClN4O4S and a molecular weight of 336.80 g/mol. Its IUPAC name is 5-nitro-N-(piperidin-3-ylmethyl)pyridine-2-sulfonamide;hydrochloride.
| Compound Name | 5-nitro-N-(piperidin-3-ylmethyl)pyridine-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 71635724 |
| Molecular Formula | C11H17ClN4O4S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 5-nitro-N-(piperidin-3-ylmethyl)pyridine-2-sulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(S(=O)(=O)NCC2CCCNC2)nc1 |
| InChI | InChI=1S/C11H16N4O4S.ClH/c16-15(17)10-3-4-11(13-8-10)20(18,19)14-7-9-2-1-5-12-6-9;/h3-4,8-9,12,14H,1-2,5-7H2;1H |
| InChIKey | SGGMRSWJANDAQB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|