C14H18F3N — CID 115058938
2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 115058938) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 115058938 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | CC1(Cc2cccc(C(F)(F)F)c2)CCCCN1 |
| InChI | InChI=1S/C14H18F3N/c1-13(7-2-3-8-18-13)10-11-5-4-6-12(9-11)14(15,16)17/h4-6,9,18H,2-3,7-8,10H2,1H3 |
| InChIKey | KBKLPWPKIINVLW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |