C16H18F3N — CID 65389527
1-[[3-(trifluoromethyl)phenyl]methyl]cycloheptane-1-carbonitrile (PubChem CID 65389527) has the molecular formula C16H18F3N and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]cycloheptane-1-carbonitrile.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 65389527 |
| Molecular Formula | C16H18F3N |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]cycloheptane-1-carbonitrile |
| SMILES | N#CC1(Cc2cccc(C(F)(F)F)c2)CCCCCC1 |
| InChI | InChI=1S/C16H18F3N/c17-16(18,19)14-7-5-6-13(10-14)11-15(12-20)8-3-1-2-4-9-15/h5-7,10H,1-4,8-9,11H2 |
| InChIKey | KHLHIQUNFIDOFD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |