C14H16ClF3 — CID 66034453
1-[[1-(chloromethyl)cyclopentyl]methyl]-3-(trifluoromethyl)benzene (PubChem CID 66034453) has the molecular formula C14H16ClF3 and a molecular weight of 276.73 g/mol. Its IUPAC name is 1-[[1-(chloromethyl)cyclopentyl]methyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[[1-(chloromethyl)cyclopentyl]methyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 66034453 |
| Molecular Formula | C14H16ClF3 |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[[1-(chloromethyl)cyclopentyl]methyl]-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(CC2(CCl)CCCC2)c1 |
| InChI | InChI=1S/C14H16ClF3/c15-10-13(6-1-2-7-13)9-11-4-3-5-12(8-11)14(16,17)18/h3-5,8H,1-2,6-7,9-10H2 |
| InChIKey | VUVULQDCDDIGMU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|