C13H16F3NS — CID 83173473
[2-[[3-(trifluoromethyl)phenyl]methyl]thiolan-2-yl]methanamine (PubChem CID 83173473) has the molecular formula C13H16F3NS and a molecular weight of 275.34 g/mol. Its IUPAC name is [2-[[3-(trifluoromethyl)phenyl]methyl]thiolan-2-yl]methanamine.
| Compound Name | [2-[[3-(trifluoromethyl)phenyl]methyl]thiolan-2-yl]methanamine |
|---|---|
| PubChem CID | 83173473 |
| Molecular Formula | C13H16F3NS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [2-[[3-(trifluoromethyl)phenyl]methyl]thiolan-2-yl]methanamine |
| SMILES | NCC1(Cc2cccc(C(F)(F)F)c2)CCCS1 |
| InChI | InChI=1S/C13H16F3NS/c14-13(15,16)11-4-1-3-10(7-11)8-12(9-17)5-2-6-18-12/h1,3-4,7H,2,5-6,8-9,17H2 |
| InChIKey | HSXMDYVMLFMXMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |