C16H21F3O — CID 65149544
2-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexan-1-ol (PubChem CID 65149544) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexan-1-ol.
| Compound Name | 2-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65149544 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclohexan-1-ol |
| SMILES | CCC1CCCCC1(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3O/c1-2-13-7-3-4-9-15(13,20)11-12-6-5-8-14(10-12)16(17,18)19/h5-6,8,10,13,20H,2-4,7,9,11H2,1H3 |
| InChIKey | ZFYMNRWMKIHWQV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |