C15H19F3O — CID 65154101
3-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclopentan-1-ol (PubChem CID 65154101) has the molecular formula C15H19F3O and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclopentan-1-ol.
| Compound Name | 3-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65154101 |
| Molecular Formula | C15H19F3O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-ethyl-1-[[3-(trifluoromethyl)phenyl]methyl]cyclopentan-1-ol |
| SMILES | CCC1CCC(O)(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H19F3O/c1-2-11-6-7-14(19,9-11)10-12-4-3-5-13(8-12)15(16,17)18/h3-5,8,11,19H,2,6-7,9-10H2,1H3 |
| InChIKey | DKIDRSAKEXZCDN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |