C14H18ClFO — CID 103039036
1-[(3-chloro-4-fluorophenyl)methyl]-3-ethylcyclopentan-1-ol (PubChem CID 103039036) has the molecular formula C14H18ClFO and a molecular weight of 256.75 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-ethylcyclopentan-1-ol.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-ethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 103039036 |
| Molecular Formula | C14H18ClFO |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-ethylcyclopentan-1-ol |
| SMILES | CCC1CCC(O)(Cc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClFO/c1-2-10-5-6-14(17,8-10)9-11-3-4-13(16)12(15)7-11/h3-4,7,10,17H,2,5-6,8-9H2,1H3 |
| InChIKey | ZBOZPPVUFSGDJN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |