C18H25Cl2F — CID 103042014
4-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-2-chloro-1-fluorobenzene (PubChem CID 103042014) has the molecular formula C18H25Cl2F and a molecular weight of 331.30 g/mol. Its IUPAC name is 4-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-2-chloro-1-fluorobenzene.
| Compound Name | 4-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-2-chloro-1-fluorobenzene |
|---|---|
| PubChem CID | 103042014 |
| Molecular Formula | C18H25Cl2F |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-2-chloro-1-fluorobenzene |
| SMILES | CCCCC1CCC(CCl)(Cc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H25Cl2F/c1-2-3-4-14-7-9-18(13-19,10-8-14)12-15-5-6-17(21)16(20)11-15/h5-6,11,14H,2-4,7-10,12-13H2,1H3 |
| InChIKey | WXVDRTKSVWYXEX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|