C18H25BrClF — CID 79698209
1-bromo-3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-5-fluorobenzene (PubChem CID 79698209) has the molecular formula C18H25BrClF and a molecular weight of 375.75 g/mol. Its IUPAC name is 1-bromo-3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-5-fluorobenzene.
| Compound Name | 1-bromo-3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-5-fluorobenzene |
|---|---|
| PubChem CID | 79698209 |
| Molecular Formula | C18H25BrClF |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-bromo-3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-5-fluorobenzene |
| SMILES | CCCCC1CCC(CCl)(Cc2cc(F)cc(Br)c2)CC1 |
| InChI | InChI=1S/C18H25BrClF/c1-2-3-4-14-5-7-18(13-20,8-6-14)12-15-9-16(19)11-17(21)10-15/h9-11,14H,2-8,12-13H2,1H3 |
| InChIKey | MEXXMIOZXQLHOD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|